C28H34N6O2 — CID 95064505
N-[3-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]-2-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)acetamide (PubChem CID 95064505) has the molecular formula C28H34N6O2 and a molecular weight of 486.62 g/mol. Its IUPAC name is N-[3-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]-2-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)acetamide.
| Compound Name | N-[3-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]-2-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)acetamide |
|---|---|
| PubChem CID | 95064505 |
| Molecular Formula | C28H34N6O2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | N-[3-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]-2-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)acetamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)Cn3c4ccccc4c4cnn(C)c(=O)c43)C[C@@H]2C)c1 |
| InChI | InChI=1S/C28H34N6O2/c1-20-8-6-9-22(16-20)33-15-14-32(18-21(33)2)13-7-12-29-26(35)19-34-25-11-5-4-10-23(25)24-17-30-31(3)28(36)27(24)34/h4-6,8-11,16-17,21H,7,12-15,18-19H2,1-3H3,(H,29,35)/t21-/m0/s1 |
| InChIKey | GYTYTEXPVNLIGA-NRFANRHFSA-N |
| XLogP | 2.91 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|