C30H34N4O2 — CID 39303950
N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 39303950) has the molecular formula C30H34N4O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 39303950 |
| Molecular Formula | C30H34N4O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)Cn3c4ccccc4c(=O)c4ccccc43)CC2)c1 |
| InChI | InChI=1S/C30H34N4O2/c1-23-9-8-10-24(21-23)33-19-17-32(18-20-33)16-7-6-15-31-29(35)22-34-27-13-4-2-11-25(27)30(36)26-12-3-5-14-28(26)34/h2-5,8-14,21H,6-7,15-20,22H2,1H3,(H,31,35) |
| InChIKey | VPUHCRYDXMVSTF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|