C27H35N5O2 — CID 39303958
3-(8-methyl-4-oxoquinazolin-3-yl)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]propanamide (PubChem CID 39303958) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is 3-(8-methyl-4-oxoquinazolin-3-yl)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]propanamide.
| Compound Name | 3-(8-methyl-4-oxoquinazolin-3-yl)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]propanamide |
|---|---|
| PubChem CID | 39303958 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | 3-(8-methyl-4-oxoquinazolin-3-yl)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]propanamide |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)CCn3cnc4c(C)cccc4c3=O)CC2)c1 |
| InChI | InChI=1S/C27H35N5O2/c1-21-7-5-9-23(19-21)31-17-15-30(16-18-31)13-4-3-12-28-25(33)11-14-32-20-29-26-22(2)8-6-10-24(26)27(32)34/h5-10,19-20H,3-4,11-18H2,1-2H3,(H,28,33) |
| InChIKey | JQMMYCDCFDIVST-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|