C23H28N4O2 — CID 55619017
N-[3-[4-(dimethylamino)phenyl]propyl]-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide (PubChem CID 55619017) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[3-[4-(dimethylamino)phenyl]propyl]-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide.
| Compound Name | N-[3-[4-(dimethylamino)phenyl]propyl]-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 55619017 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N-[3-[4-(dimethylamino)phenyl]propyl]-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide |
| SMILES | Cc1cccc2c(=O)n(CCC(=O)NCCCc3ccc(N(C)C)cc3)cnc12 |
| InChI | InChI=1S/C23H28N4O2/c1-17-6-4-8-20-22(17)25-16-27(23(20)29)15-13-21(28)24-14-5-7-18-9-11-19(12-10-18)26(2)3/h4,6,8-12,16H,5,7,13-15H2,1-3H3,(H,24,28) |
| InChIKey | GUUPVTJQVONJCX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|