C25H35N3O2 — CID 55624420
3-(2,3-dimethylphenoxy)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]propanamide (PubChem CID 55624420) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is 3-(2,3-dimethylphenoxy)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]propanamide.
| Compound Name | 3-(2,3-dimethylphenoxy)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 55624420 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 3-(2,3-dimethylphenoxy)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]propanamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)CCOc3cccc(C)c3C)CC2)c1 |
| InChI | InChI=1S/C25H35N3O2/c1-20-7-4-9-23(19-20)28-16-14-27(15-17-28)13-6-12-26-25(29)11-18-30-24-10-5-8-21(2)22(24)3/h4-5,7-10,19H,6,11-18H2,1-3H3,(H,26,29) |
| InChIKey | CQQKMPYVCGTMDF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|