C27H35N5OS — CID 55653220
2-[1-(2,3-dimethylphenyl)imidazol-2-yl]sulfanyl-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]acetamide (PubChem CID 55653220) has the molecular formula C27H35N5OS and a molecular weight of 477.68 g/mol. Its IUPAC name is 2-[1-(2,3-dimethylphenyl)imidazol-2-yl]sulfanyl-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]acetamide.
| Compound Name | 2-[1-(2,3-dimethylphenyl)imidazol-2-yl]sulfanyl-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 55653220 |
| Molecular Formula | C27H35N5OS |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 2-[1-(2,3-dimethylphenyl)imidazol-2-yl]sulfanyl-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]acetamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)CSc3nccn3-c3cccc(C)c3C)CC2)c1 |
| InChI | InChI=1S/C27H35N5OS/c1-21-7-4-9-24(19-21)31-17-15-30(16-18-31)13-6-11-28-26(33)20-34-27-29-12-14-32(27)25-10-5-8-22(2)23(25)3/h4-5,7-10,12,14,19H,6,11,13,15-18,20H2,1-3H3,(H,28,33) |
| InChIKey | SKCRDTJAXFOHMY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|