C23H32N4OS — CID 55826376
N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-(pyridin-2-ylmethylsulfanyl)acetamide (PubChem CID 55826376) has the molecular formula C23H32N4OS and a molecular weight of 412.60 g/mol. Its IUPAC name is N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-(pyridin-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-(pyridin-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 55826376 |
| Molecular Formula | C23H32N4OS |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-(pyridin-2-ylmethylsulfanyl)acetamide |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)CSCc3ccccn3)CC2)c1 |
| InChI | InChI=1S/C23H32N4OS/c1-20-7-6-9-22(17-20)27-15-13-26(14-16-27)12-5-4-11-25-23(28)19-29-18-21-8-2-3-10-24-21/h2-3,6-10,17H,4-5,11-16,18-19H2,1H3,(H,25,28) |
| InChIKey | UZMZHKSFMKRBMV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|