C24H33FN4O3S — CID 55662298
3-[(4-fluorophenyl)sulfonylamino]-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]propanamide (PubChem CID 55662298) has the molecular formula C24H33FN4O3S and a molecular weight of 476.62 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)sulfonylamino]-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]propanamide.
| Compound Name | 3-[(4-fluorophenyl)sulfonylamino]-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]propanamide |
|---|---|
| PubChem CID | 55662298 |
| Molecular Formula | C24H33FN4O3S |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 3-[(4-fluorophenyl)sulfonylamino]-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]propanamide |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)CCNS(=O)(=O)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C24H33FN4O3S/c1-20-5-4-6-22(19-20)29-17-15-28(16-18-29)14-3-2-12-26-24(30)11-13-27-33(31,32)23-9-7-21(25)8-10-23/h4-10,19,27H,2-3,11-18H2,1H3,(H,26,30) |
| InChIKey | RCHSQXKIGYMCGE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|