C24H33N5O2 — CID 93052166
4-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]butanamide (PubChem CID 93052166) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 4-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]butanamide.
| Compound Name | 4-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]butanamide |
|---|---|
| PubChem CID | 93052166 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 4-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]butanamide |
| SMILES | C[C@H]1CCCN(CCCNC(=O)CCCn2c3ccccc3c3cnn(C)c(=O)c32)C1 |
| InChI | InChI=1S/C24H33N5O2/c1-18-8-5-13-28(17-18)14-7-12-25-22(30)11-6-15-29-21-10-4-3-9-19(21)20-16-26-27(2)24(31)23(20)29/h3-4,9-10,16,18H,5-8,11-15,17H2,1-2H3,(H,25,30)/t18-/m0/s1 |
| InChIKey | SNUXTQLWFYFBJB-SFHVURJKSA-N |
| XLogP | 2.91 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|