C27H34N4O2 — CID 93052161
N-[(1S)-1-(1-adamantyl)ethyl]-4-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)butanamide (PubChem CID 93052161) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-4-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)butanamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)butanamide |
|---|---|
| PubChem CID | 93052161 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-(3-methyl-4-oxopyridazino[4,5-b]indol-5-yl)butanamide |
| SMILES | C[C@H](NC(=O)CCCn1c2ccccc2c2cnn(C)c(=O)c21)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H34N4O2/c1-17(27-13-18-10-19(14-27)12-20(11-18)15-27)29-24(32)8-5-9-31-23-7-4-3-6-21(23)22-16-28-30(2)26(33)25(22)31/h3-4,6-7,16-20H,5,8-15H2,1-2H3,(H,29,32)/t17-,18?,19?,20?,27?/m0/s1 |
| InChIKey | MYRBONCSYAORHA-AWYKWWOESA-N |
| XLogP | 4.39 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |