C23H30N2O2S — CID 92679023
N-[(1R)-1-(1-adamantyl)ethyl]-4-(3-oxo-1,2-benzothiazol-2-yl)butanamide (PubChem CID 92679023) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-4-(3-oxo-1,2-benzothiazol-2-yl)butanamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-4-(3-oxo-1,2-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 92679023 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-4-(3-oxo-1,2-benzothiazol-2-yl)butanamide |
| SMILES | C[C@@H](NC(=O)CCCn1sc2ccccc2c1=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H30N2O2S/c1-15(23-12-16-9-17(13-23)11-18(10-16)14-23)24-21(26)7-4-8-25-22(27)19-5-2-3-6-20(19)28-25/h2-3,5-6,15-18H,4,7-14H2,1H3,(H,24,26)/t15-,16?,17?,18?,23?/m1/s1 |
| InChIKey | BGFZQCLPEXYZKA-LRYXAPPNSA-N |
| XLogP | 4.56 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |