C19H20N2O2S — CID 22515047
N-(2,4-dimethylphenyl)-4-(3-oxo-1,2-benzothiazol-2-yl)butanamide (PubChem CID 22515047) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-(3-oxo-1,2-benzothiazol-2-yl)butanamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-(3-oxo-1,2-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 22515047 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-(3-oxo-1,2-benzothiazol-2-yl)butanamide |
| SMILES | Cc1ccc(NC(=O)CCCn2sc3ccccc3c2=O)c(C)c1 |
| InChI | InChI=1S/C19H20N2O2S/c1-13-9-10-16(14(2)12-13)20-18(22)8-5-11-21-19(23)15-6-3-4-7-17(15)24-21/h3-4,6-7,9-10,12H,5,8,11H2,1-2H3,(H,20,22) |
| InChIKey | YZGOOUVFCMNEHY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |