C12H14BrNOS — CID 71347664
2-(5-bromopentyl)-1,2-benzothiazol-3-one (PubChem CID 71347664) has the molecular formula C12H14BrNOS and a molecular weight of 300.22 g/mol. Its IUPAC name is 2-(5-bromopentyl)-1,2-benzothiazol-3-one.
| Compound Name | 2-(5-bromopentyl)-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 71347664 |
| Molecular Formula | C12H14BrNOS |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 2-(5-bromopentyl)-1,2-benzothiazol-3-one |
| SMILES | O=c1c2ccccc2sn1CCCCCBr |
| InChI | InChI=1S/C12H14BrNOS/c13-8-4-1-5-9-14-12(15)10-6-2-3-7-11(10)16-14/h2-3,6-7H,1,4-5,8-9H2 |
| InChIKey | AIMCUDLPHPWRGH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|