About 2-prop-2-ynyl-1,2-benzothiazol-3-one
2-prop-2-ynyl-1,2-benzothiazol-3-one (PubChem CID 53315389) has the molecular formula C10H7NOS
and a molecular weight of 189.24 g/mol. Its IUPAC name is 2-prop-2-ynyl-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 2-prop-2-ynyl-1,2-benzothiazol-3-one |
| PubChem CID | 53315389 |
| Molecular Formula | C10H7NOS |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 2-prop-2-ynyl-1,2-benzothiazol-3-one |
| SMILES | C#CCn1sc2ccccc2c1=O |
| InChI | InChI=1S/C10H7NOS/c1-2-7-11-10(12)8-5-3-4-6-9(8)13-11/h1,3-6H,7H2 |
| InChIKey | OMMASUYCUALCEV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-ynyl-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-ynyl-1,2-benzothiazol-3-one?
The IUPAC name of 2-prop-2-ynyl-1,2-benzothiazol-3-one (CID 53315389) is 2-prop-2-ynyl-1,2-benzothiazol-3-one.
What is the SMILES notation for 2-prop-2-ynyl-1,2-benzothiazol-3-one?
The canonical SMILES for 2-prop-2-ynyl-1,2-benzothiazol-3-one is C#CCn1sc2ccccc2c1=O.
What is the InChIKey of 2-prop-2-ynyl-1,2-benzothiazol-3-one?
The InChIKey is OMMASUYCUALCEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NOS/c1-2-7-11-10(12)8-5-3-4-6-9(8)13-11/h1,3-6H,7H2.
What are the key properties of 2-prop-2-ynyl-1,2-benzothiazol-3-one?
2-prop-2-ynyl-1,2-benzothiazol-3-one has a molecular weight of 189.24 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-ynyl-1,2-benzothiazol-3-one is sourced from PubChem (CID 53315389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).