C12H15NO2S — CID 104550664
2-(3-hydroxy-2,2-dimethylpropyl)-1,2-benzothiazol-3-one (PubChem CID 104550664) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-(3-hydroxy-2,2-dimethylpropyl)-1,2-benzothiazol-3-one.
| Compound Name | 2-(3-hydroxy-2,2-dimethylpropyl)-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 104550664 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-(3-hydroxy-2,2-dimethylpropyl)-1,2-benzothiazol-3-one |
| SMILES | CC(C)(CO)Cn1sc2ccccc2c1=O |
| InChI | InChI=1S/C12H15NO2S/c1-12(2,8-14)7-13-11(15)9-5-3-4-6-10(9)16-13/h3-6,14H,7-8H2,1-2H3 |
| InChIKey | LKUSIOCWSAZFEO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |