C10H9NO4S — CID 81435653
2-hydroxy-3-(3-oxo-1,2-benzothiazol-2-yl)propanoic acid (PubChem CID 81435653) has the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. Its IUPAC name is 2-hydroxy-3-(3-oxo-1,2-benzothiazol-2-yl)propanoic acid.
| Compound Name | 2-hydroxy-3-(3-oxo-1,2-benzothiazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 81435653 |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 2-hydroxy-3-(3-oxo-1,2-benzothiazol-2-yl)propanoic acid |
| SMILES | O=C(O)C(O)Cn1sc2ccccc2c1=O |
| InChI | InChI=1S/C10H9NO4S/c12-7(10(14)15)5-11-9(13)6-3-1-2-4-8(6)16-11/h1-4,7,12H,5H2,(H,14,15) |
| InChIKey | PRIUQFFLJJNQKN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |