C19H17NO4S — CID 58466360
2-benzyl-4-oxo-5-(3-oxo-1,2-benzothiazol-2-yl)pentanoic acid (PubChem CID 58466360) has the molecular formula C19H17NO4S and a molecular weight of 355.41 g/mol. Its IUPAC name is 2-benzyl-4-oxo-5-(3-oxo-1,2-benzothiazol-2-yl)pentanoic acid.
| Compound Name | 2-benzyl-4-oxo-5-(3-oxo-1,2-benzothiazol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 58466360 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-benzyl-4-oxo-5-(3-oxo-1,2-benzothiazol-2-yl)pentanoic acid |
| SMILES | O=C(CC(Cc1ccccc1)C(=O)O)Cn1sc2ccccc2c1=O |
| InChI | InChI=1S/C19H17NO4S/c21-15(11-14(19(23)24)10-13-6-2-1-3-7-13)12-20-18(22)16-8-4-5-9-17(16)25-20/h1-9,14H,10-12H2,(H,23,24) |
| InChIKey | VSWWKHKOKDZYEN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |