C27H25N3O5S — CID 58466365
benzyl N-[[2-benzyl-4-oxo-5-(3-oxo-1,2-benzothiazol-2-yl)pentanoyl]amino]carbamate (PubChem CID 58466365) has the molecular formula C27H25N3O5S and a molecular weight of 503.58 g/mol. Its IUPAC name is benzyl N-[[2-benzyl-4-oxo-5-(3-oxo-1,2-benzothiazol-2-yl)pentanoyl]amino]carbamate.
| Compound Name | benzyl N-[[2-benzyl-4-oxo-5-(3-oxo-1,2-benzothiazol-2-yl)pentanoyl]amino]carbamate |
|---|---|
| PubChem CID | 58466365 |
| Molecular Formula | C27H25N3O5S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | benzyl N-[[2-benzyl-4-oxo-5-(3-oxo-1,2-benzothiazol-2-yl)pentanoyl]amino]carbamate |
| SMILES | O=C(CC(Cc1ccccc1)C(=O)NNC(=O)OCc1ccccc1)Cn1sc2ccccc2c1=O |
| InChI | InChI=1S/C27H25N3O5S/c31-22(17-30-26(33)23-13-7-8-14-24(23)36-30)16-21(15-19-9-3-1-4-10-19)25(32)28-29-27(34)35-18-20-11-5-2-6-12-20/h1-14,21H,15-18H2,(H,28,32)(H,29,34) |
| InChIKey | ZLBQITMVLMIFEX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|