C24H31N3O5 — CID 67089774
benzyl N-[(2R)-2-(phenylmethoxycarbonylaminocarbamoyl)heptyl]carbamate (PubChem CID 67089774) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is benzyl N-[(2R)-2-(phenylmethoxycarbonylaminocarbamoyl)heptyl]carbamate.
| Compound Name | benzyl N-[(2R)-2-(phenylmethoxycarbonylaminocarbamoyl)heptyl]carbamate |
|---|---|
| PubChem CID | 67089774 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | benzyl N-[(2R)-2-(phenylmethoxycarbonylaminocarbamoyl)heptyl]carbamate |
| SMILES | CCCCC[C@H](CNC(=O)OCc1ccccc1)C(=O)NNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H31N3O5/c1-2-3-6-15-21(16-25-23(29)31-17-19-11-7-4-8-12-19)22(28)26-27-24(30)32-18-20-13-9-5-10-14-20/h4-5,7-14,21H,2-3,6,15-18H2,1H3,(H,25,29)(H,26,28)(H,27,30)/t21-/m1/s1 |
| InChIKey | YFCALZQAHBBTGP-OAQYLSRUSA-N |
| XLogP | 4.07 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|