C13H13NOS — CID 106209056
2-hex-5-ynyl-1,2-benzothiazol-3-one (PubChem CID 106209056) has the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. Its IUPAC name is 2-hex-5-ynyl-1,2-benzothiazol-3-one.
| Compound Name | 2-hex-5-ynyl-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 106209056 |
| Molecular Formula | C13H13NOS |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-hex-5-ynyl-1,2-benzothiazol-3-one |
| SMILES | C#CCCCCn1sc2ccccc2c1=O |
| InChI | InChI=1S/C13H13NOS/c1-2-3-4-7-10-14-13(15)11-8-5-6-9-12(11)16-14/h1,5-6,8-9H,3-4,7,10H2 |
| InChIKey | MKUXNNDWJWWNPM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|