C24H28N4O3 — CID 92752267
1-ethyl-4-[2-[(3R)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]quinoxaline-2,3-dione (PubChem CID 92752267) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1-ethyl-4-[2-[(3R)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]quinoxaline-2,3-dione.
| Compound Name | 1-ethyl-4-[2-[(3R)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 92752267 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-ethyl-4-[2-[(3R)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]quinoxaline-2,3-dione |
| SMILES | CCn1c(=O)c(=O)n(CC(=O)N2CCN(c3cccc(C)c3)[C@H](C)C2)c2ccccc21 |
| InChI | InChI=1S/C24H28N4O3/c1-4-26-20-10-5-6-11-21(20)28(24(31)23(26)30)16-22(29)25-12-13-27(18(3)15-25)19-9-7-8-17(2)14-19/h5-11,14,18H,4,12-13,15-16H2,1-3H3/t18-/m1/s1 |
| InChIKey | NOFPQECILKTVTM-GOSISDBHSA-N |
| XLogP | 2.23 |
| TPSA | 67.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|