C17H24N2O3 — CID 134069407
5-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-5-oxopentanoic acid (PubChem CID 134069407) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 5-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-5-oxopentanoic acid.
| Compound Name | 5-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 134069407 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 5-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-5-oxopentanoic acid |
| SMILES | Cc1cccc(N2CCN(C(=O)CCCC(=O)O)CC2C)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-13-5-3-6-15(11-13)19-10-9-18(12-14(19)2)16(20)7-4-8-17(21)22/h3,5-6,11,14H,4,7-10,12H2,1-2H3,(H,21,22) |
| InChIKey | LDXRJHZGZKFUGU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |