C21H26N2O2 — CID 2481312
2-(3-methoxyphenyl)-1-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]ethanone (PubChem CID 2481312) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3-methoxyphenyl)-1-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 2481312 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-(3-methoxyphenyl)-1-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1cccc(CC(=O)N2CCN(c3cccc(C)c3)[C@@H](C)C2)c1 |
| InChI | InChI=1S/C21H26N2O2/c1-16-6-4-8-19(12-16)23-11-10-22(15-17(23)2)21(24)14-18-7-5-9-20(13-18)25-3/h4-9,12-13,17H,10-11,14-15H2,1-3H3/t17-/m0/s1 |
| InChIKey | MAPUKAZVUQQQRE-KRWDZBQOSA-N |
| XLogP | 3.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |