C19H25N3O3S2 — CID 15995654
N-[3-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-3-oxopropyl]thiophene-2-sulfonamide (PubChem CID 15995654) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[3-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-3-oxopropyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-3-oxopropyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 15995654 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[3-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]-3-oxopropyl]thiophene-2-sulfonamide |
| SMILES | Cc1cccc(N2CCN(C(=O)CCNS(=O)(=O)c3cccs3)CC2C)c1 |
| InChI | InChI=1S/C19H25N3O3S2/c1-15-5-3-6-17(13-15)22-11-10-21(14-16(22)2)18(23)8-9-20-27(24,25)19-7-4-12-26-19/h3-7,12-13,16,20H,8-11,14H2,1-2H3 |
| InChIKey | YEZMNVHAWKRRPT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |