C17H20N2O3S2 — CID 3240002
N-(4-methylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 3240002) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-(4-methylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(4-methylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3240002 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-(4-methylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCCN(S(=O)(=O)c3cccs3)C2)cc1 |
| InChI | InChI=1S/C17H20N2O3S2/c1-13-6-8-15(9-7-13)18-17(20)14-4-2-10-19(12-14)24(21,22)16-5-3-11-23-16/h3,5-9,11,14H,2,4,10,12H2,1H3,(H,18,20) |
| InChIKey | AWRQIRAOBCNIDH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |