C17H18Br2N2O3S2 — CID 15989602
N-(4-bromo-3-methylphenyl)-1-(5-bromothiophen-2-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 15989602) has the molecular formula C17H18Br2N2O3S2 and a molecular weight of 522.28 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-1-(5-bromothiophen-2-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-1-(5-bromothiophen-2-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 15989602 |
| Molecular Formula | C17H18Br2N2O3S2 |
| Molecular Weight | 522.28 g/mol |
| Exact Mass | 519.91 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-1-(5-bromothiophen-2-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CCCN(S(=O)(=O)c3ccc(Br)s3)C2)ccc1Br |
| InChI | InChI=1S/C17H18Br2N2O3S2/c1-11-9-13(4-5-14(11)18)20-17(22)12-3-2-8-21(10-12)26(23,24)16-7-6-15(19)25-16/h4-7,9,12H,2-3,8,10H2,1H3,(H,20,22) |
| InChIKey | GKJNGIUPHMMUIA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |