C16H17BrN2O3S2 — CID 2307871
N-(2-bromophenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 2307871) has the molecular formula C16H17BrN2O3S2 and a molecular weight of 429.36 g/mol. Its IUPAC name is N-(2-bromophenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-bromophenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 2307871 |
| Molecular Formula | C16H17BrN2O3S2 |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | N-(2-bromophenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1Br)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C16H17BrN2O3S2/c17-13-4-1-2-5-14(13)18-16(20)12-7-9-19(10-8-12)24(21,22)15-6-3-11-23-15/h1-6,11-12H,7-10H2,(H,18,20) |
| InChIKey | NRTYECBKRTXYED-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |