C27H31N3O2S — CID 92666787
N-[3-[(3R)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 92666787) has the molecular formula C27H31N3O2S and a molecular weight of 461.63 g/mol. Its IUPAC name is N-[3-[(3R)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]-4H-thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-[3-[(3R)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]-4H-thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 92666787 |
| Molecular Formula | C27H31N3O2S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-[3-[(3R)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)c3cc4c(s3)-c3ccccc3OC4)C[C@H]2C)c1 |
| InChI | InChI=1S/C27H31N3O2S/c1-19-7-5-8-22(15-19)30-14-13-29(17-20(30)2)12-6-11-28-27(31)25-16-21-18-32-24-10-4-3-9-23(24)26(21)33-25/h3-5,7-10,15-16,20H,6,11-14,17-18H2,1-2H3,(H,28,31)/t20-/m1/s1 |
| InChIKey | FYXBWCHZYQXSTO-HXUWFJFHSA-N |
| XLogP | 4.95 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|