C20H24N2O3S — CID 20877717
9-methyl-N-(3-morpholin-4-ylpropyl)-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 20877717) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 9-methyl-N-(3-morpholin-4-ylpropyl)-4H-thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | 9-methyl-N-(3-morpholin-4-ylpropyl)-4H-thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 20877717 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 9-methyl-N-(3-morpholin-4-ylpropyl)-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | Cc1cccc2c1-c1sc(C(=O)NCCCN3CCOCC3)cc1CO2 |
| InChI | InChI=1S/C20H24N2O3S/c1-14-4-2-5-16-18(14)19-15(13-25-16)12-17(26-19)20(23)21-6-3-7-22-8-10-24-11-9-22/h2,4-5,12H,3,6-11,13H2,1H3,(H,21,23) |
| InChIKey | XCEXKXZFEINDSY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|