C22H28N2O2S — CID 20877886
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 20877886) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4H-thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4H-thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 20877886 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)c2cc3c(s2)-c2ccccc2OC3)C1 |
| InChI | InChI=1S/C22H28N2O2S/c1-15-10-16(2)13-24(12-15)9-5-8-23-22(25)20-11-17-14-26-19-7-4-3-6-18(19)21(17)27-20/h3-4,6-7,11,15-16H,5,8-10,12-14H2,1-2H3,(H,23,25) |
| InChIKey | QXMIBDJBYORMSG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|