C19H16N2O4S — CID 134046907
N-[2-(furan-2-carbonylamino)ethyl]-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 134046907) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is N-[2-(furan-2-carbonylamino)ethyl]-4H-thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-[2-(furan-2-carbonylamino)ethyl]-4H-thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 134046907 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-[2-(furan-2-carbonylamino)ethyl]-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cc2c(s1)-c1ccccc1OC2)c1ccco1 |
| InChI | InChI=1S/C19H16N2O4S/c22-18(15-6-3-9-24-15)20-7-8-21-19(23)16-10-12-11-25-14-5-2-1-4-13(14)17(12)26-16/h1-6,9-10H,7-8,11H2,(H,20,22)(H,21,23) |
| InChIKey | WTSVOWMYJKCHIU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|