C20H15FN2O3S — CID 31725309
N'-[2-(4-fluorophenyl)acetyl]-4H-thieno[3,2-c]chromene-2-carbohydrazide (PubChem CID 31725309) has the molecular formula C20H15FN2O3S and a molecular weight of 382.42 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)acetyl]-4H-thieno[3,2-c]chromene-2-carbohydrazide.
| Compound Name | N'-[2-(4-fluorophenyl)acetyl]-4H-thieno[3,2-c]chromene-2-carbohydrazide |
|---|---|
| PubChem CID | 31725309 |
| Molecular Formula | C20H15FN2O3S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N'-[2-(4-fluorophenyl)acetyl]-4H-thieno[3,2-c]chromene-2-carbohydrazide |
| SMILES | O=C(Cc1ccc(F)cc1)NNC(=O)c1cc2c(s1)-c1ccccc1OC2 |
| InChI | InChI=1S/C20H15FN2O3S/c21-14-7-5-12(6-8-14)9-18(24)22-23-20(25)17-10-13-11-26-16-4-2-1-3-15(16)19(13)27-17/h1-8,10H,9,11H2,(H,22,24)(H,23,25) |
| InChIKey | OMXUADJDYMLQDS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|