C21H17FN2O2S — CID 46656887
N'-[2-(4-fluorophenyl)acetyl]-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide (PubChem CID 46656887) has the molecular formula C21H17FN2O2S and a molecular weight of 380.44 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)acetyl]-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide.
| Compound Name | N'-[2-(4-fluorophenyl)acetyl]-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide |
|---|---|
| PubChem CID | 46656887 |
| Molecular Formula | C21H17FN2O2S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N'-[2-(4-fluorophenyl)acetyl]-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide |
| SMILES | O=C(Cc1ccc(F)cc1)NNC(=O)c1cc2c(s1)-c1ccccc1CC2 |
| InChI | InChI=1S/C21H17FN2O2S/c22-16-9-5-13(6-10-16)11-19(25)23-24-21(26)18-12-15-8-7-14-3-1-2-4-17(14)20(15)27-18/h1-6,9-10,12H,7-8,11H2,(H,23,25)(H,24,26) |
| InChIKey | AZUYVPLHEYYOKL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|