C14H13NOS — CID 1490444
N-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxamide (PubChem CID 1490444) has the molecular formula C14H13NOS and a molecular weight of 243.33 g/mol. Its IUPAC name is N-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxamide.
| Compound Name | N-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxamide |
|---|---|
| PubChem CID | 1490444 |
| Molecular Formula | C14H13NOS |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxamide |
| SMILES | CNC(=O)c1cc2c(s1)-c1ccccc1CC2 |
| InChI | InChI=1S/C14H13NOS/c1-15-14(16)12-8-10-7-6-9-4-2-3-5-11(9)13(10)17-12/h2-5,8H,6-7H2,1H3,(H,15,16) |
| InChIKey | ADOUOUVBTDMDIV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |