About N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide
N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide (PubChem CID 3683314) has the molecular formula C14H14N2O3S2
and a molecular weight of 322.41 g/mol. Its IUPAC name is N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide.
Molecular Properties
| Compound Name | N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide |
| PubChem CID | 3683314 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide |
| SMILES | CS(=O)(=O)NNC(=O)c1cc2c(s1)-c1ccccc1CC2 |
| InChI | InChI=1S/C14H14N2O3S2/c1-21(18,19)16-15-14(17)12-8-10-7-6-9-4-2-3-5-11(9)13(10)20-12/h2-5,8,16H,6-7H2,1H3,(H,15,17) |
| InChIKey | XKGRLWMUQFSLKQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide?
The IUPAC name of N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide (CID 3683314) is N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide.
What is the SMILES notation for N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide?
The canonical SMILES for N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide is CS(=O)(=O)NNC(=O)c1cc2c(s1)-c1ccccc1CC2.
What is the InChIKey of N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide?
The InChIKey is XKGRLWMUQFSLKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3S2/c1-21(18,19)16-15-14(17)12-8-10-7-6-9-4-2-3-5-11(9)13(10)20-12/h2-5,8,16H,6-7H2,1H3,(H,15,17).
What are the key properties of N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide?
N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide has a molecular weight of 322.41 g/mol, XLogP of 1.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methylsulfonyl-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide is sourced from PubChem (CID 3683314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).