C13H12N2OS — CID 2826309
4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide (PubChem CID 2826309) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is 4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide.
| Compound Name | 4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide |
|---|---|
| PubChem CID | 2826309 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide |
| SMILES | NNC(=O)c1cc2c(s1)-c1ccccc1CC2 |
| InChI | InChI=1S/C13H12N2OS/c14-15-13(16)11-7-9-6-5-8-3-1-2-4-10(8)12(9)17-11/h1-4,7H,5-6,14H2,(H,15,16) |
| InChIKey | KFGFRPWZQKMMNV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|