C13H11NO4S2 — CID 137370062
4,5-dihydrobenzo[g][1]benzothiole-2-carbonylsulfamic acid (PubChem CID 137370062) has the molecular formula C13H11NO4S2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4,5-dihydrobenzo[g][1]benzothiole-2-carbonylsulfamic acid.
| Compound Name | 4,5-dihydrobenzo[g][1]benzothiole-2-carbonylsulfamic acid |
|---|---|
| PubChem CID | 137370062 |
| Molecular Formula | C13H11NO4S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 4,5-dihydrobenzo[g][1]benzothiole-2-carbonylsulfamic acid |
| SMILES | O=C(NS(=O)(=O)O)c1cc2c(s1)-c1ccccc1CC2 |
| InChI | InChI=1S/C13H11NO4S2/c15-13(14-20(16,17)18)11-7-9-6-5-8-3-1-2-4-10(8)12(9)19-11/h1-4,7H,5-6H2,(H,14,15)(H,16,17,18) |
| InChIKey | MGQCGYONWXYMBZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|