C16H15N3O3S — CID 134024021
2-(4,5-dihydrobenzo[g][1]benzothiole-2-carbonylamino)propanediamide (PubChem CID 134024021) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-(4,5-dihydrobenzo[g][1]benzothiole-2-carbonylamino)propanediamide.
| Compound Name | 2-(4,5-dihydrobenzo[g][1]benzothiole-2-carbonylamino)propanediamide |
|---|---|
| PubChem CID | 134024021 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-(4,5-dihydrobenzo[g][1]benzothiole-2-carbonylamino)propanediamide |
| SMILES | NC(=O)C(NC(=O)c1cc2c(s1)-c1ccccc1CC2)C(N)=O |
| InChI | InChI=1S/C16H15N3O3S/c17-14(20)12(15(18)21)19-16(22)11-7-9-6-5-8-3-1-2-4-10(8)13(9)23-11/h1-4,7,12H,5-6H2,(H2,17,20)(H2,18,21)(H,19,22) |
| InChIKey | DLCXGCVBQVFBBT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|