C22H20N2O4S — CID 25393836
N'-(3,4-dimethoxybenzoyl)-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide (PubChem CID 25393836) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is N'-(3,4-dimethoxybenzoyl)-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide.
| Compound Name | N'-(3,4-dimethoxybenzoyl)-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide |
|---|---|
| PubChem CID | 25393836 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N'-(3,4-dimethoxybenzoyl)-4,5-dihydrobenzo[g][1]benzothiole-2-carbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2cc3c(s2)-c2ccccc2CC3)cc1OC |
| InChI | InChI=1S/C22H20N2O4S/c1-27-17-10-9-15(11-18(17)28-2)21(25)23-24-22(26)19-12-14-8-7-13-5-3-4-6-16(13)20(14)29-19/h3-6,9-12H,7-8H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | JSOMLXIYVGZEBR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|