C21H18N2O2S — CID 8701361
N-(4-acetamidophenyl)-4,5-dihydrobenzo[g][1]benzothiole-2-carboxamide (PubChem CID 8701361) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-4,5-dihydrobenzo[g][1]benzothiole-2-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-4,5-dihydrobenzo[g][1]benzothiole-2-carboxamide |
|---|---|
| PubChem CID | 8701361 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-(4-acetamidophenyl)-4,5-dihydrobenzo[g][1]benzothiole-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cc3c(s2)-c2ccccc2CC3)cc1 |
| InChI | InChI=1S/C21H18N2O2S/c1-13(24)22-16-8-10-17(11-9-16)23-21(25)19-12-15-7-6-14-4-2-3-5-18(14)20(15)26-19/h2-5,8-12H,6-7H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | MYNSXDXAGJWTJZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |