C17H17NO4S — CID 119199749
2-methyl-2-(4H-thieno[3,2-c]chromene-2-carbonylamino)butanoic acid (PubChem CID 119199749) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-methyl-2-(4H-thieno[3,2-c]chromene-2-carbonylamino)butanoic acid.
| Compound Name | 2-methyl-2-(4H-thieno[3,2-c]chromene-2-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 119199749 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-methyl-2-(4H-thieno[3,2-c]chromene-2-carbonylamino)butanoic acid |
| SMILES | CCC(C)(NC(=O)c1cc2c(s1)-c1ccccc1OC2)C(=O)O |
| InChI | InChI=1S/C17H17NO4S/c1-3-17(2,16(20)21)18-15(19)13-8-10-9-22-12-7-5-4-6-11(12)14(10)23-13/h4-8H,3,9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | CQTGBEYVZYFWNZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |