C25H26N4O3S — CID 17446228
N'-[3-(4-phenylpiperazin-1-yl)propanoyl]-4H-thieno[3,2-c]chromene-2-carbohydrazide (PubChem CID 17446228) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is N'-[3-(4-phenylpiperazin-1-yl)propanoyl]-4H-thieno[3,2-c]chromene-2-carbohydrazide.
| Compound Name | N'-[3-(4-phenylpiperazin-1-yl)propanoyl]-4H-thieno[3,2-c]chromene-2-carbohydrazide |
|---|---|
| PubChem CID | 17446228 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N'-[3-(4-phenylpiperazin-1-yl)propanoyl]-4H-thieno[3,2-c]chromene-2-carbohydrazide |
| SMILES | O=C(CCN1CCN(c2ccccc2)CC1)NNC(=O)c1cc2c(s1)-c1ccccc1OC2 |
| InChI | InChI=1S/C25H26N4O3S/c30-23(10-11-28-12-14-29(15-13-28)19-6-2-1-3-7-19)26-27-25(31)22-16-18-17-32-21-9-5-4-8-20(21)24(18)33-22/h1-9,16H,10-15,17H2,(H,26,30)(H,27,31) |
| InChIKey | POFBELBSYYFLRW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|