C16H15NO4S — CID 119224142
2-(4H-thieno[3,2-c]chromene-2-carbonylamino)butanoic acid (PubChem CID 119224142) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-(4H-thieno[3,2-c]chromene-2-carbonylamino)butanoic acid.
| Compound Name | 2-(4H-thieno[3,2-c]chromene-2-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 119224142 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-(4H-thieno[3,2-c]chromene-2-carbonylamino)butanoic acid |
| SMILES | CCC(NC(=O)c1cc2c(s1)-c1ccccc1OC2)C(=O)O |
| InChI | InChI=1S/C16H15NO4S/c1-2-11(16(19)20)17-15(18)13-7-9-8-21-12-6-4-3-5-10(12)14(9)22-13/h3-7,11H,2,8H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | TUUPNCMUGDXQOV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |