C21H18N2O3S — CID 134019153
N-(3-acetamido-2-methylphenyl)-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 134019153) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-(3-acetamido-2-methylphenyl)-4H-thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-(3-acetamido-2-methylphenyl)-4H-thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 134019153 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-(3-acetamido-2-methylphenyl)-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)c2cc3c(s2)-c2ccccc2OC3)c1C |
| InChI | InChI=1S/C21H18N2O3S/c1-12-16(22-13(2)24)7-5-8-17(12)23-21(25)19-10-14-11-26-18-9-4-3-6-15(18)20(14)27-19/h3-10H,11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | WKBFTCAOUXNMAP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |