C23H22N2O3S — CID 34400383
N-[3-(diethylcarbamoyl)phenyl]-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 34400383) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-[3-(diethylcarbamoyl)phenyl]-4H-thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-[3-(diethylcarbamoyl)phenyl]-4H-thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 34400383 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-[3-(diethylcarbamoyl)phenyl]-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)c2cc3c(s2)-c2ccccc2OC3)c1 |
| InChI | InChI=1S/C23H22N2O3S/c1-3-25(4-2)23(27)15-8-7-9-17(12-15)24-22(26)20-13-16-14-28-19-11-6-5-10-18(19)21(16)29-20/h5-13H,3-4,14H2,1-2H3,(H,24,26) |
| InChIKey | JTJVKSLTMTUVGI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |