C20H14N2O3S2 — CID 35875668
N-(3-oxo-4H-1,4-benzothiazin-6-yl)-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 35875668) has the molecular formula C20H14N2O3S2 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzothiazin-6-yl)-4H-thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-4H-thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 35875668 |
| Molecular Formula | C20H14N2O3S2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | O=C1CSc2ccc(NC(=O)c3cc4c(s3)-c3ccccc3OC4)cc2N1 |
| InChI | InChI=1S/C20H14N2O3S2/c23-18-10-26-16-6-5-12(8-14(16)22-18)21-20(24)17-7-11-9-25-15-4-2-1-3-13(15)19(11)27-17/h1-8H,9-10H2,(H,21,24)(H,22,23) |
| InChIKey | KYFNJGWCTVWEBC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |