C21H14N2O4S — CID 55332902
N-(2-methyl-1,3-dioxoisoindol-5-yl)-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 55332902) has the molecular formula C21H14N2O4S and a molecular weight of 390.42 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-4H-thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-4H-thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 55332902 |
| Molecular Formula | C21H14N2O4S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)c3cc4c(s3)-c3ccccc3OC4)cc2C1=O |
| InChI | InChI=1S/C21H14N2O4S/c1-23-20(25)13-7-6-12(9-15(13)21(23)26)22-19(24)17-8-11-10-27-16-5-3-2-4-14(16)18(11)28-17/h2-9H,10H2,1H3,(H,22,24) |
| InChIKey | FXQKPXRXCLRDBN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|