C19H16N2O4 — CID 46628982
N-(2-methyl-1,3-dioxoisoindol-5-yl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 46628982) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 46628982 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)C3COc4ccccc4C3)cc2C1=O |
| InChI | InChI=1S/C19H16N2O4/c1-21-18(23)14-7-6-13(9-15(14)19(21)24)20-17(22)12-8-11-4-2-3-5-16(11)25-10-12/h2-7,9,12H,8,10H2,1H3,(H,20,22) |
| InChIKey | SWYFTMJTRLLSPU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|