C16H14BrNO2 — CID 22578129
N-(4-bromophenyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 22578129) has the molecular formula C16H14BrNO2 and a molecular weight of 332.20 g/mol. Its IUPAC name is N-(4-bromophenyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-(4-bromophenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 22578129 |
| Molecular Formula | C16H14BrNO2 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | N-(4-bromophenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)C1COc2ccccc2C1 |
| InChI | InChI=1S/C16H14BrNO2/c17-13-5-7-14(8-6-13)18-16(19)12-9-11-3-1-2-4-15(11)20-10-12/h1-8,12H,9-10H2,(H,18,19) |
| InChIKey | WQNWHLYOQGTTSD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |