C16H14INO2 — CID 9245036
(3S)-N-(3-iodophenyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 9245036) has the molecular formula C16H14INO2 and a molecular weight of 379.20 g/mol. Its IUPAC name is (3S)-N-(3-iodophenyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | (3S)-N-(3-iodophenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 9245036 |
| Molecular Formula | C16H14INO2 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | (3S)-N-(3-iodophenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(Nc1cccc(I)c1)[C@@H]1COc2ccccc2C1 |
| InChI | InChI=1S/C16H14INO2/c17-13-5-3-6-14(9-13)18-16(19)12-8-11-4-1-2-7-15(11)20-10-12/h1-7,9,12H,8,10H2,(H,18,19)/t12-/m0/s1 |
| InChIKey | ZQPDJSIONMKMBL-LBPRGKRZSA-N |
| XLogP | 3.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|